C9H13FOS — CID 153361556
5-[(E)-2-fluoroprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-4-thiol (PubChem CID 153361556) has the molecular formula C9H13FOS and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-[(E)-2-fluoroprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-4-thiol.
| Compound Name | 5-[(E)-2-fluoroprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-4-thiol |
|---|---|
| PubChem CID | 153361556 |
| Molecular Formula | C9H13FOS |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 5-[(E)-2-fluoroprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-4-thiol |
| SMILES | CC1=C(/C=C(\C)F)C(S)CCO1 |
| InChI | InChI=1S/C9H13FOS/c1-6(10)5-8-7(2)11-4-3-9(8)12/h5,9,12H,3-4H2,1-2H3/b6-5+ |
| InChIKey | QCZSKXMZGYGJNL-AATRIKPKSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|