C11H17FO — CID 142207001
1-butoxy-2-fluoro-4-methylcyclohexa-1,3-diene (PubChem CID 142207001) has the molecular formula C11H17FO and a molecular weight of 184.25 g/mol. Its IUPAC name is 1-butoxy-2-fluoro-4-methylcyclohexa-1,3-diene.
| Compound Name | 1-butoxy-2-fluoro-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142207001 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-butoxy-2-fluoro-4-methylcyclohexa-1,3-diene |
| SMILES | CCCCOC1=C(F)C=C(C)CC1 |
| InChI | InChI=1S/C11H17FO/c1-3-4-7-13-11-6-5-9(2)8-10(11)12/h8H,3-7H2,1-2H3 |
| InChIKey | ZTFLKDHTJGYZSL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|