C11H15FO — CID 89189819
(7R)-6-ethyl-7-fluoro-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 89189819) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is (7R)-6-ethyl-7-fluoro-3,4,7,8-tetrahydro-2H-chromene.
| Compound Name | (7R)-6-ethyl-7-fluoro-3,4,7,8-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 89189819 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (7R)-6-ethyl-7-fluoro-3,4,7,8-tetrahydro-2H-chromene |
| SMILES | CCC1=CC2=C(C[C@H]1F)OCCC2 |
| InChI | InChI=1S/C11H15FO/c1-2-8-6-9-4-3-5-13-11(9)7-10(8)12/h6,10H,2-5,7H2,1H3/t10-/m1/s1 |
| InChIKey | JVXFEJIOUPEWKH-SNVBAGLBSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |