C8H12OS — CID 90961704
(4-methoxycyclohexa-1,3-dien-1-yl)methanethiol (PubChem CID 90961704) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is (4-methoxycyclohexa-1,3-dien-1-yl)methanethiol.
| Compound Name | (4-methoxycyclohexa-1,3-dien-1-yl)methanethiol |
|---|---|
| PubChem CID | 90961704 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (4-methoxycyclohexa-1,3-dien-1-yl)methanethiol |
| SMILES | COC1=CC=C(CS)CC1 |
| InChI | InChI=1S/C8H12OS/c1-9-8-4-2-7(6-10)3-5-8/h2,4,10H,3,5-6H2,1H3 |
| InChIKey | ZAKXCMCPOMPVPE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|