C11H17IO — CID 143470513
1-butoxy-4-(iodomethyl)cyclohexa-1,3-diene (PubChem CID 143470513) has the molecular formula C11H17IO and a molecular weight of 292.16 g/mol. Its IUPAC name is 1-butoxy-4-(iodomethyl)cyclohexa-1,3-diene.
| Compound Name | 1-butoxy-4-(iodomethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143470513 |
| Molecular Formula | C11H17IO |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-butoxy-4-(iodomethyl)cyclohexa-1,3-diene |
| SMILES | CCCCOC1=CC=C(CI)CC1 |
| InChI | InChI=1S/C11H17IO/c1-2-3-8-13-11-6-4-10(9-12)5-7-11/h4,6H,2-3,5,7-9H2,1H3 |
| InChIKey | WLNHLHMZOASQFW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|