C9H14OS — CID 143874026
4-methoxy-2,6-dimethylcyclohexa-1,3-diene-1-thiol (PubChem CID 143874026) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethylcyclohexa-1,3-diene-1-thiol.
| Compound Name | 4-methoxy-2,6-dimethylcyclohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143874026 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 4-methoxy-2,6-dimethylcyclohexa-1,3-diene-1-thiol |
| SMILES | COC1=CC(C)=C(S)C(C)C1 |
| InChI | InChI=1S/C9H14OS/c1-6-4-8(10-3)5-7(2)9(6)11/h4,7,11H,5H2,1-3H3 |
| InChIKey | ROJUUFNEPVSLAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|