C12H19FOS — CID 143343212
2-fluoro-5-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene;methanethiol (PubChem CID 143343212) has the molecular formula C12H19FOS and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-fluoro-5-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene;methanethiol.
| Compound Name | 2-fluoro-5-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene;methanethiol |
|---|---|
| PubChem CID | 143343212 |
| Molecular Formula | C12H19FOS |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-fluoro-5-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene;methanethiol |
| SMILES | CC1=CCC(OC(C)C)=C(F)C=C1.CS |
| InChI | InChI=1S/C11H15FO.CH4S/c1-8(2)13-11-7-5-9(3)4-6-10(11)12;1-2/h4-6,8H,7H2,1-3H3;2H,1H3 |
| InChIKey | WRPSLTIMLHIJFO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|