C25H44O2S — CID 142070083
(Z)-1-[2-[(Z)-4,4-dimethylpent-2-en-3-yl]oxyethylsulfanyl]-3-[2-[(4Z,6Z)-octa-4,6-dienoxy]ethyl]hex-3-ene (PubChem CID 142070083) has the molecular formula C25H44O2S and a molecular weight of 408.69 g/mol. Its IUPAC name is (Z)-1-[2-[(Z)-4,4-dimethylpent-2-en-3-yl]oxyethylsulfanyl]-3-[2-[(4Z,6Z)-octa-4,6-dienoxy]ethyl]hex-3-ene.
| Compound Name | (Z)-1-[2-[(Z)-4,4-dimethylpent-2-en-3-yl]oxyethylsulfanyl]-3-[2-[(4Z,6Z)-octa-4,6-dienoxy]ethyl]hex-3-ene |
|---|---|
| PubChem CID | 142070083 |
| Molecular Formula | C25H44O2S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (Z)-1-[2-[(Z)-4,4-dimethylpent-2-en-3-yl]oxyethylsulfanyl]-3-[2-[(4Z,6Z)-octa-4,6-dienoxy]ethyl]hex-3-ene |
| SMILES | C/C=C\C=C/CCCOCC/C(=C/CC)CCSCCO/C(=C\C)C(C)(C)C |
| InChI | InChI=1S/C25H44O2S/c1-7-10-11-12-13-14-18-26-19-16-23(15-8-2)17-21-28-22-20-27-24(9-3)25(4,5)6/h7,9-12,15H,8,13-14,16-22H2,1-6H3/b10-7-,12-11-,23-15-,24-9- |
| InChIKey | DMCDWJAJHMEEGN-LETHYXDWSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|