C40H68OS — CID 155697762
3-tert-butyl-1-[(1E,3Z)-2-tert-butyl-4-[(3E,5E)-3,5-ditert-butylhepta-3,5-dienoxy]-5,5-dimethylhexa-1,3-dienyl]-6,6-dimethyl-1λ4-thiabicyclo[3.2.1]octa-3,5(8)-diene (PubChem CID 155697762) has the molecular formula C40H68OS and a molecular weight of 597.05 g/mol. Its IUPAC name is 3-tert-butyl-1-[(1E,3Z)-2-tert-butyl-4-[(3E,5E)-3,5-ditert-butylhepta-3,5-dienoxy]-5,5-dimethylhexa-1,3-dienyl]-6,6-dimethyl-1λ4-thiabicyclo[3.2.1]octa-3,5(8)-diene.
| Compound Name | 3-tert-butyl-1-[(1E,3Z)-2-tert-butyl-4-[(3E,5E)-3,5-ditert-butylhepta-3,5-dienoxy]-5,5-dimethylhexa-1,3-dienyl]-6,6-dimethyl-1λ4-thiabicyclo[3.2.1]octa-3,5(8)-diene |
|---|---|
| PubChem CID | 155697762 |
| Molecular Formula | C40H68OS |
| Molecular Weight | 597.05 g/mol |
| Exact Mass | 596.50 |
| IUPAC Name | 3-tert-butyl-1-[(1E,3Z)-2-tert-butyl-4-[(3E,5E)-3,5-ditert-butylhepta-3,5-dienoxy]-5,5-dimethylhexa-1,3-dienyl]-6,6-dimethyl-1λ4-thiabicyclo[3.2.1]octa-3,5(8)-diene |
| SMILES | C/C=C(\C=C(/CCO/C(=C\C(=C/S12C=C(C=C(C(C)(C)C)C1)C(C)(C)C2)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C40H68OS/c1-19-29(35(2,3)4)22-30(36(5,6)7)20-21-41-34(39(14,15)16)24-32(38(11,12)13)26-42-25-31(37(8,9)10)23-33(27-42)40(17,18)28-42/h19,22-24,26-27H,20-21,25,28H2,1-18H3/b29-19+,30-22+,32-26+,34-24- |
| InChIKey | WBBMZWSVDOQSBC-YAHOHCJPSA-N |
| XLogP | 12.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.05 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|