C17H27OSV- — CID 176919971
4,8-dimethyl-5-methylsulfanyl-3,7-dihydro-2H-1-benzoxepin-7-ide;ethane;vanadium (PubChem CID 176919971) has the molecular formula C17H27OSV- and a molecular weight of 330.41 g/mol. Its IUPAC name is 4,8-dimethyl-5-methylsulfanyl-3,7-dihydro-2H-1-benzoxepin-7-ide;ethane;vanadium.
| Compound Name | 4,8-dimethyl-5-methylsulfanyl-3,7-dihydro-2H-1-benzoxepin-7-ide;ethane;vanadium |
|---|---|
| PubChem CID | 176919971 |
| Molecular Formula | C17H27OSV- |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4,8-dimethyl-5-methylsulfanyl-3,7-dihydro-2H-1-benzoxepin-7-ide;ethane;vanadium |
| SMILES | CC.CC.CSC1=C(C)CCOc2cc(C)[c-]cc21.[V] |
| InChI | InChI=1S/C13H15OS.2C2H6.V/c1-9-4-5-11-12(8-9)14-7-6-10(2)13(11)15-3;2*1-2;/h5,8H,6-7H2,1-3H3;2*1-2H3;/q-1;;; |
| InChIKey | JPWRPWAFTLXRAD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|