C12H18OS — CID 166546429
4-[(1Z)-4-methyl-1-methylsulfanylpenta-1,3-dienyl]-3,6-dihydro-2H-pyran (PubChem CID 166546429) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 4-[(1Z)-4-methyl-1-methylsulfanylpenta-1,3-dienyl]-3,6-dihydro-2H-pyran.
| Compound Name | 4-[(1Z)-4-methyl-1-methylsulfanylpenta-1,3-dienyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 166546429 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 4-[(1Z)-4-methyl-1-methylsulfanylpenta-1,3-dienyl]-3,6-dihydro-2H-pyran |
| SMILES | CS/C(=C\C=C(C)C)C1=CCOCC1 |
| InChI | InChI=1S/C12H18OS/c1-10(2)4-5-12(14-3)11-6-8-13-9-7-11/h4-6H,7-9H2,1-3H3/b12-5- |
| InChIKey | QCLGOHLGSGUGIA-XGICHPGQSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|