C16H14F3NO2 — CID 134921506
(E)-4-ethoxy-1,1,1-trifluoro-4-(naphthalen-2-ylamino)but-3-en-2-one (PubChem CID 134921506) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is (E)-4-ethoxy-1,1,1-trifluoro-4-(naphthalen-2-ylamino)but-3-en-2-one.
| Compound Name | (E)-4-ethoxy-1,1,1-trifluoro-4-(naphthalen-2-ylamino)but-3-en-2-one |
|---|---|
| PubChem CID | 134921506 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (E)-4-ethoxy-1,1,1-trifluoro-4-(naphthalen-2-ylamino)but-3-en-2-one |
| SMILES | CCO/C(=C/C(=O)C(F)(F)F)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H14F3NO2/c1-2-22-15(10-14(21)16(17,18)19)20-13-8-7-11-5-3-4-6-12(11)9-13/h3-10,20H,2H2,1H3/b15-10+ |
| InChIKey | DJNXMVJJVBGPLA-XNTDXEJSSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|