C13H22O6 — CID 134922710
2-[(4R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 134922710) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-[(4R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 134922710 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[(4R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(C)(C)O[C@H](CC=O)C2O)O1 |
| InChI | InChI=1S/C13H22O6/c1-12(2)16-7-9(18-12)11-10(15)8(5-6-14)17-13(3,4)19-11/h6,8-11,15H,5,7H2,1-4H3/t8-,9-,10?,11-/m1/s1 |
| InChIKey | YAMFZMQPLDRDLY-JHOLWCCGSA-N |
| XLogP | 0.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|