C24H33NO6 — CID 134922894
(2R)-2-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3S)-3-methoxy-2-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde (PubChem CID 134922894) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3S)-3-methoxy-2-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde.
| Compound Name | (2R)-2-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3S)-3-methoxy-2-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 134922894 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (2R)-2-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3S)-3-methoxy-2-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde |
| SMILES | CO[C@H]1CN([C@@H](C=O)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]2COC(C)(C)O2)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H33NO6/c1-23(2)28-15-20(29-23)22-21(30-24(3,4)31-22)18(14-26)25-13-19(27-5)17(25)12-11-16-9-7-6-8-10-16/h6-12,14,17-22H,13,15H2,1-5H3/b12-11+/t17-,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | WAHOIGOXVYLNCX-PWMMMKRESA-N |
| XLogP | 2.64 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|