C24H31NO7 — CID 11826409
(2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde (PubChem CID 11826409) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde.
| Compound Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 11826409 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]acetaldehyde |
| SMILES | CO[C@H]1C(=O)N([C@@H](C=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H31NO7/c1-23(2)29-14-18(30-23)21-19(31-24(3,4)32-21)17(13-26)25-16(20(28-5)22(25)27)12-11-15-9-7-6-8-10-15/h6-13,16-21H,14H2,1-5H3/b12-11+/t16-,17-,18+,19+,20+,21+/m0/s1 |
| InChIKey | RDZYVVNZUXFBLT-YENXVJEMSA-N |
| XLogP | 2.16 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|