C26H33NO9 — CID 11145560
benzyl (E)-3-[(2R,3S)-1-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate (PubChem CID 11145560) has the molecular formula C26H33NO9 and a molecular weight of 503.55 g/mol. Its IUPAC name is benzyl (E)-3-[(2R,3S)-1-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[(2R,3S)-1-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11145560 |
| Molecular Formula | C26H33NO9 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | benzyl (E)-3-[(2R,3S)-1-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate |
| SMILES | CO[C@@H]1C(=O)N([C@@H](C=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)[C@@H]1/C=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO9/c1-25(2)33-15-19(34-25)23-21(35-26(3,4)36-23)18(13-28)27-17(22(31-5)24(27)30)11-12-20(29)32-14-16-9-7-6-8-10-16/h6-13,17-19,21-23H,14-15H2,1-5H3/b12-11+/t17-,18+,19-,21-,22+,23-/m1/s1 |
| InChIKey | AECSNUZOWZQYLE-WFOFJINUSA-N |
| XLogP | 1.75 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|