C26H39NO8 — CID 135001485
tert-butyl (4R)-4-[(S)-[(4S,5R)-5-ethoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135001485) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(S)-[(4S,5R)-5-ethoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(S)-[(4S,5R)-5-ethoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135001485 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | tert-butyl (4R)-4-[(S)-[(4S,5R)-5-ethoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(C)(C)O[C@H]1[C@@H](OCc1ccccc1)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39NO8/c1-9-30-22(28)21-20(33-26(7,8)34-21)19(31-15-17-13-11-10-12-14-17)18-16-32-25(5,6)27(18)23(29)35-24(2,3)4/h10-14,18-21H,9,15-16H2,1-8H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | XPPNGNVQHBNTBQ-IVAOSVALSA-N |
| XLogP | 4.03 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |