C27H35NO13 — CID 11124728
methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 11124728) has the molecular formula C27H35NO13 and a molecular weight of 581.57 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11124728 |
| Molecular Formula | C27H35NO13 |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OCc2ccccc2)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C27H35NO13/c1-15(29)28-23-21(38-17(3)31)12-27(26(34)35-6,37-13-20-10-8-7-9-11-20)41-25(23)24(40-19(5)33)22(39-18(4)32)14-36-16(2)30/h7-11,21-25H,12-14H2,1-6H3,(H,28,29)/t21-,22+,23+,24+,25+,27+/m0/s1 |
| InChIKey | PCDVSOJVTSULHL-XDRRYPFFSA-N |
| XLogP | 0.72 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|