C29H43NO10 — CID 11478599
tert-butyl (4R)-4-[(R)-hydroxy-[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11478599) has the molecular formula C29H43NO10 and a molecular weight of 565.66 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(R)-hydroxy-[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(R)-hydroxy-[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11478599 |
| Molecular Formula | C29H43NO10 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | tert-butyl (4R)-4-[(R)-hydroxy-[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@@H]1OC(C)(C)O[C@@]1(C(=O)OC)[C@H](O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43NO10/c1-11-21(36-16-18-12-14-19(34-9)15-13-18)23-29(24(32)35-10,40-28(7,8)38-23)22(31)20-17-37-27(5,6)30(20)25(33)39-26(2,3)4/h11-15,20-23,31H,1,16-17H2,2-10H3/t20-,21-,22-,23+,29+/m1/s1 |
| InChIKey | CCLIADPJHVQABS-ZFLLLYJLSA-N |
| XLogP | 3.56 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|