C24H33NO7 — CID 11442242
benzyl (4R,5S)-4-[(1R)-1-hydroxy-1-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11442242) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is benzyl (4R,5S)-4-[(1R)-1-hydroxy-1-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4R,5S)-4-[(1R)-1-hydroxy-1-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11442242 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | benzyl (4R,5S)-4-[(1R)-1-hydroxy-1-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)N(C(=O)OCc2ccccc2)[C@H]1[C@@](C)(O)[C@H]1OC2(CCCCC2)OC1=O |
| InChI | InChI=1S/C24H33NO7/c1-16-18(23(4,28)19-20(26)32-24(31-19)13-9-6-10-14-24)25(22(2,3)30-16)21(27)29-15-17-11-7-5-8-12-17/h5,7-8,11-12,16,18-19,28H,6,9-10,13-15H2,1-4H3/t16-,18+,19-,23+/m0/s1 |
| InChIKey | CAYXKFWNRZNHEF-QYUDBREXSA-N |
| XLogP | 3.50 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |