C29H43NO12 — CID 171121409
tert-butyl (1R,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,14,16,17,18-pentahydroxy-10,11-dimethoxy-3-oxo-5-phenyl-4,19-dioxa-8-azabicyclo[13.3.1]nonadec-12-ene-8-carboxylate (PubChem CID 171121409) has the molecular formula C29H43NO12 and a molecular weight of 597.66 g/mol. Its IUPAC name is tert-butyl (1R,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,14,16,17,18-pentahydroxy-10,11-dimethoxy-3-oxo-5-phenyl-4,19-dioxa-8-azabicyclo[13.3.1]nonadec-12-ene-8-carboxylate.
| Compound Name | tert-butyl (1R,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,14,16,17,18-pentahydroxy-10,11-dimethoxy-3-oxo-5-phenyl-4,19-dioxa-8-azabicyclo[13.3.1]nonadec-12-ene-8-carboxylate |
|---|---|
| PubChem CID | 171121409 |
| Molecular Formula | C29H43NO12 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | tert-butyl (1R,5S,10S,11R,12E,14S,15S,16S,17S,18R)-1,14,16,17,18-pentahydroxy-10,11-dimethoxy-3-oxo-5-phenyl-4,19-dioxa-8-azabicyclo[13.3.1]nonadec-12-ene-8-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC[C@@H](c2ccccc2)OC(=O)C[C@@]2(O)O[C@H]([C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)/C=C/[C@H]1OC |
| InChI | InChI=1S/C29H43NO12/c1-28(2,3)42-27(36)30-14-13-19(17-9-7-6-8-10-17)40-22(32)15-29(37)26(35)24(34)23(33)25(41-29)18(31)11-12-20(38-4)21(16-30)39-5/h6-12,18-21,23-26,31,33-35,37H,13-16H2,1-5H3/b12-11+/t18-,19-,20+,21-,23-,24-,25-,26+,29+/m0/s1 |
| InChIKey | UJTHCGWAAIHXIG-XOHANVENSA-N |
| XLogP | 0.42 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|