C26H30O6 — CID 134923017
(2R,3S,4S,5R)-2,5-bis(phenylmethoxy)-3,4-bis(prop-2-enoxy)hexanedial (PubChem CID 134923017) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis(phenylmethoxy)-3,4-bis(prop-2-enoxy)hexanedial.
| Compound Name | (2R,3S,4S,5R)-2,5-bis(phenylmethoxy)-3,4-bis(prop-2-enoxy)hexanedial |
|---|---|
| PubChem CID | 134923017 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis(phenylmethoxy)-3,4-bis(prop-2-enoxy)hexanedial |
| SMILES | C=CCO[C@@H]([C@H](OCC=C)[C@H](C=O)OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H30O6/c1-3-15-29-25(23(17-27)31-19-21-11-7-5-8-12-21)26(30-16-4-2)24(18-28)32-20-22-13-9-6-10-14-22/h3-14,17-18,23-26H,1-2,15-16,19-20H2/t23-,24-,25+,26+/m0/s1 |
| InChIKey | OKLVKMZJPKBIGN-QEGGNFSNSA-N |
| XLogP | 3.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|