C12H20N4O2 — CID 134923462
(2E)-4-cyano-5,5-bis(dimethylamino)-3-methoxy-N-methylpenta-2,4-dienamide (PubChem CID 134923462) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is (2E)-4-cyano-5,5-bis(dimethylamino)-3-methoxy-N-methylpenta-2,4-dienamide.
| Compound Name | (2E)-4-cyano-5,5-bis(dimethylamino)-3-methoxy-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 134923462 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2E)-4-cyano-5,5-bis(dimethylamino)-3-methoxy-N-methylpenta-2,4-dienamide |
| SMILES | CNC(=O)/C=C(/OC)C(C#N)=C(N(C)C)N(C)C |
| InChI | InChI=1S/C12H20N4O2/c1-14-11(17)7-10(18-6)9(8-13)12(15(2)3)16(4)5/h7H,1-6H3,(H,14,17)/b10-7+ |
| InChIKey | BBDQCEYECQIZQR-JXMROGBWSA-N |
| XLogP | 0.12 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|