C16H30N2 — CID 134923532
(1Z,3E)-1-piperidin-1-yl-N,N-dipropylpenta-1,3-dien-1-amine (PubChem CID 134923532) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (1Z,3E)-1-piperidin-1-yl-N,N-dipropylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-piperidin-1-yl-N,N-dipropylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134923532 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (1Z,3E)-1-piperidin-1-yl-N,N-dipropylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C=C(/N(CCC)CCC)N1CCCCC1 |
| InChI | InChI=1S/C16H30N2/c1-4-7-11-16(17(12-5-2)13-6-3)18-14-9-8-10-15-18/h4,7,11H,5-6,8-10,12-15H2,1-3H3/b7-4+,16-11- |
| InChIKey | ZPTOWYDWHUZIND-CHLGNXTCSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|