C14H26N2 — CID 23267230
(1Z,3Z)-N,N-diethyl-1-piperidin-1-ylpenta-1,3-dien-1-amine (PubChem CID 23267230) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (1Z,3Z)-N,N-diethyl-1-piperidin-1-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-N,N-diethyl-1-piperidin-1-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 23267230 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (1Z,3Z)-N,N-diethyl-1-piperidin-1-ylpenta-1,3-dien-1-amine |
| SMILES | C/C=C\C=C(\N(CC)CC)N1CCCCC1 |
| InChI | InChI=1S/C14H26N2/c1-4-7-11-14(15(5-2)6-3)16-12-9-8-10-13-16/h4,7,11H,5-6,8-10,12-13H2,1-3H3/b7-4-,14-11- |
| InChIKey | KWIWBPKHXSVVTE-WIDWAAGQSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|