C12H25N3 — CID 145198069
ethane;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine (PubChem CID 145198069) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine.
| Compound Name | ethane;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145198069 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | ethane;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCCCC1.CC |
| InChI | InChI=1S/C10H19N3.C2H6/c1-9(11)5-6-10(12)13-7-3-2-4-8-13;1-2/h5-6H,2-4,7-8,11-12H2,1H3;1-2H3/b9-5-,10-6+; |
| InChIKey | UYWLQHUIZFSKTG-KSTRYXAPSA-N |
| XLogP | 2.16 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|