C10H18FN3 — CID 145197707
(1E,3Z)-1-(3-fluoropiperidin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 145197707) has the molecular formula C10H18FN3 and a molecular weight of 199.27 g/mol. Its IUPAC name is (1E,3Z)-1-(3-fluoropiperidin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(3-fluoropiperidin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145197707 |
| Molecular Formula | C10H18FN3 |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | (1E,3Z)-1-(3-fluoropiperidin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCCC(F)C1 |
| InChI | InChI=1S/C10H18FN3/c1-8(12)4-5-10(13)14-6-2-3-9(11)7-14/h4-5,9H,2-3,6-7,12-13H2,1H3/b8-4-,10-5+ |
| InChIKey | BVRDRXWCKKPRPX-HZEUFOEUSA-N |
| XLogP | 1.08 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|