C12H19FN2 — CID 156739146
(2Z,4Z)-3-(4-fluoropiperidin-1-yl)hepta-2,4,6-trien-2-amine (PubChem CID 156739146) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is (2Z,4Z)-3-(4-fluoropiperidin-1-yl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-3-(4-fluoropiperidin-1-yl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 156739146 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (2Z,4Z)-3-(4-fluoropiperidin-1-yl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(=C(/C)N)N1CCC(F)CC1 |
| InChI | InChI=1S/C12H19FN2/c1-3-4-5-12(10(2)14)15-8-6-11(13)7-9-15/h3-5,11H,1,6-9,14H2,2H3/b5-4-,12-10- |
| InChIKey | KNWCZVYCHXGFCA-VDBJJUDGSA-N |
| XLogP | 2.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|