C12H20FN3 — CID 139373459
1-[1-(2-fluoroethyl)piperidin-3-yl]-2H-pyridin-3-amine (PubChem CID 139373459) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-[1-(2-fluoroethyl)piperidin-3-yl]-2H-pyridin-3-amine.
| Compound Name | 1-[1-(2-fluoroethyl)piperidin-3-yl]-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 139373459 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-[1-(2-fluoroethyl)piperidin-3-yl]-2H-pyridin-3-amine |
| SMILES | NC1=CC=CN(C2CCCN(CCF)C2)C1 |
| InChI | InChI=1S/C12H20FN3/c13-5-8-15-6-2-4-12(10-15)16-7-1-3-11(14)9-16/h1,3,7,12H,2,4-6,8-10,14H2 |
| InChIKey | VTGIMDKHCNNZAU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |