C11H17FN2 — CID 143599145
(3E)-4-fluoro-5-piperidin-1-ylhexa-1,3,5-trien-2-amine (PubChem CID 143599145) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is (3E)-4-fluoro-5-piperidin-1-ylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-fluoro-5-piperidin-1-ylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143599145 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (3E)-4-fluoro-5-piperidin-1-ylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(/F)C(=C)N1CCCCC1 |
| InChI | InChI=1S/C11H17FN2/c1-9(13)8-11(12)10(2)14-6-4-3-5-7-14/h8H,1-7,13H2/b11-8+ |
| InChIKey | IGMXFFCIJMIEMB-DHZHZOJOSA-N |
| XLogP | 2.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|