C12H18F2N2 — CID 163241437
(3Z,5Z)-3-(4,4-difluoropiperidin-1-yl)hepta-1,3,5-trien-4-amine (PubChem CID 163241437) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3Z,5Z)-3-(4,4-difluoropiperidin-1-yl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5Z)-3-(4,4-difluoropiperidin-1-yl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 163241437 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3Z,5Z)-3-(4,4-difluoropiperidin-1-yl)hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(=C(N)\C=C/C)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H18F2N2/c1-3-5-10(15)11(4-2)16-8-6-12(13,14)7-9-16/h3-5H,2,6-9,15H2,1H3/b5-3-,11-10- |
| InChIKey | QJDMLFDRVFICPC-KECVDKFLSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|