C14H24F3N3 — CID 156796792
ethane;(3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine (PubChem CID 156796792) has the molecular formula C14H24F3N3 and a molecular weight of 291.36 g/mol. Its IUPAC name is ethane;(3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine.
| Compound Name | ethane;(3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156796792 |
| Molecular Formula | C14H24F3N3 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethane;(3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C)N1CCN(CC(F)(F)F)CC1.CC |
| InChI | InChI=1S/C12H18F3N3.C2H6/c1-3-10(16)11(4-2)18-7-5-17(6-8-18)9-12(13,14)15;1-2/h3-4H,1-2,5-9,16H2;1-2H3/b11-10-; |
| InChIKey | WIGVFIHYSXDETD-GMFCBQQYSA-N |
| XLogP | 2.73 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|