C12H18F3N3 — CID 156796793
(3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine (PubChem CID 156796793) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is (3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine.
| Compound Name | (3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156796793 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (3Z)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F3N3/c1-3-10(16)11(4-2)18-7-5-17(6-8-18)9-12(13,14)15/h3-4H,1-2,5-9,16H2/b11-10- |
| InChIKey | KANBZXLRKVNYNF-KHPPLWFESA-N |
| XLogP | 1.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|