C12H19F2N3 — CID 164568417
(2E,4E,6Z)-4,7-difluoro-6-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-amine (PubChem CID 164568417) has the molecular formula C12H19F2N3 and a molecular weight of 243.30 g/mol. Its IUPAC name is (2E,4E,6Z)-4,7-difluoro-6-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6Z)-4,7-difluoro-6-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 164568417 |
| Molecular Formula | C12H19F2N3 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (2E,4E,6Z)-4,7-difluoro-6-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C/C=C(N)\C(F)=C/C(=C/F)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H19F2N3/c1-3-12(15)11(14)8-10(9-13)17-6-4-16(2)5-7-17/h3,8-9H,4-7,15H2,1-2H3/b10-9-,11-8+,12-3+ |
| InChIKey | PXUVFRYLJRIVTO-WXOYJIQPSA-N |
| XLogP | 1.76 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|