C11H19F3N4 — CID 134406672
(1E,3Z)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 134406672) has the molecular formula C11H19F3N4 and a molecular weight of 264.29 g/mol. Its IUPAC name is (1E,3Z)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406672 |
| Molecular Formula | C11H19F3N4 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (1E,3Z)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N4/c1-9(15)2-3-10(16)18-6-4-17(5-7-18)8-11(12,13)14/h2-3H,4-8,15-16H2,1H3/b9-2-,10-3+ |
| InChIKey | GNZJNNWSOVLYNX-WVFLHGFDSA-N |
| XLogP | 0.83 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|