C10H20N4 — CID 134406389
(1E,3Z)-1-(4-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 134406389) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is (1E,3Z)-1-(4-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(4-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406389 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | (1E,3Z)-1-(4-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H20N4/c1-9(11)3-4-10(12)14-7-5-13(2)6-8-14/h3-4H,5-8,11-12H2,1-2H3/b9-3-,10-4+ |
| InChIKey | FQHTUGYSMSMWFF-INWPEIIHSA-N |
| XLogP | -0.10 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|