C12H26N4 — CID 134406520
(1E,3Z)-1-N'-ethyl-1-N'-[2-[ethyl(methyl)amino]ethyl]penta-1,3-diene-1,1,4-triamine (PubChem CID 134406520) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is (1E,3Z)-1-N'-ethyl-1-N'-[2-[ethyl(methyl)amino]ethyl]penta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-ethyl-1-N'-[2-[ethyl(methyl)amino]ethyl]penta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406520 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | (1E,3Z)-1-N'-ethyl-1-N'-[2-[ethyl(methyl)amino]ethyl]penta-1,3-diene-1,1,4-triamine |
| SMILES | CCN(C)CCN(CC)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C12H26N4/c1-5-15(4)9-10-16(6-2)12(14)8-7-11(3)13/h7-8H,5-6,9-10,13-14H2,1-4H3/b11-7-,12-8+ |
| InChIKey | CGWGTZISJSKLES-NTLHZVPKSA-N |
| XLogP | 0.92 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|