C8H17N3 — CID 134406316
(1E,3Z)-1-N'-ethyl-1-N'-methylpenta-1,3-diene-1,1,4-triamine (PubChem CID 134406316) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is (1E,3Z)-1-N'-ethyl-1-N'-methylpenta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-ethyl-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406316 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (1E,3Z)-1-N'-ethyl-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
| SMILES | CCN(C)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C8H17N3/c1-4-11(3)8(10)6-5-7(2)9/h5-6H,4,9-10H2,1-3H3/b7-5-,8-6+ |
| InChIKey | GDMGPJJFZOFRLW-CGXWXWIYSA-N |
| XLogP | 0.60 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|