C10H19F2N4P — CID 134406739
(1E,3Z)-1-[3-[difluoro(phosphanyl)methyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 134406739) has the molecular formula C10H19F2N4P and a molecular weight of 264.26 g/mol. Its IUPAC name is (1E,3Z)-1-[3-[difluoro(phosphanyl)methyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[3-[difluoro(phosphanyl)methyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406739 |
| Molecular Formula | C10H19F2N4P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (1E,3Z)-1-[3-[difluoro(phosphanyl)methyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCNC(C(F)(F)P)C1 |
| InChI | InChI=1S/C10H19F2N4P/c1-7(13)2-3-9(14)16-5-4-15-8(6-16)10(11,12)17/h2-3,8,15H,4-6,13-14,17H2,1H3/b7-2-,9-3+ |
| InChIKey | FFZHDOMYEFWDDB-YZSNKVSVSA-N |
| XLogP | 0.39 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|