C12H26N4 — CID 145198187
ethane;(1E,3Z)-1-(2-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 145198187) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is ethane;(1E,3Z)-1-(2-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | ethane;(1E,3Z)-1-(2-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145198187 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | ethane;(1E,3Z)-1-(2-methylpiperazin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCNCC1C.CC |
| InChI | InChI=1S/C10H20N4.C2H6/c1-8(11)3-4-10(12)14-6-5-13-7-9(14)2;1-2/h3-4,9,13H,5-7,11-12H2,1-2H3;1-2H3/b8-3-,10-4+; |
| InChIKey | ZKRGAWFTXBNRDF-KQLUFPLESA-N |
| XLogP | 0.97 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|