C9H16F3N5 — CID 145198260
(3E)-4-[2-(trifluoromethyl)piperazin-1-yl]buta-1,3-diene-1,1,4-triamine (PubChem CID 145198260) has the molecular formula C9H16F3N5 and a molecular weight of 251.26 g/mol. Its IUPAC name is (3E)-4-[2-(trifluoromethyl)piperazin-1-yl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-4-[2-(trifluoromethyl)piperazin-1-yl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 145198260 |
| Molecular Formula | C9H16F3N5 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3E)-4-[2-(trifluoromethyl)piperazin-1-yl]buta-1,3-diene-1,1,4-triamine |
| SMILES | NC(N)=C/C=C(\N)N1CCNCC1C(F)(F)F |
| InChI | InChI=1S/C9H16F3N5/c10-9(11,12)6-5-16-3-4-17(6)8(15)2-1-7(13)14/h1-2,6,16H,3-5,13-15H2/b8-2+ |
| InChIKey | YNIYEYKZHGJYJP-KRXBUXKQSA-N |
| XLogP | -0.62 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|