C12H18F2N2 — CID 156796668
(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine (PubChem CID 156796668) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine.
| Compound Name | (3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156796668 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C)N1CCC(C(F)F)CC1 |
| InChI | InChI=1S/C12H18F2N2/c1-3-10(15)11(4-2)16-7-5-9(6-8-16)12(13)14/h3-4,9,12H,1-2,5-8,15H2/b11-10- |
| InChIKey | YLSOBTZGCPZSDY-KHPPLWFESA-N |
| XLogP | 2.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|