C13H22N2 — CID 143800937
(2Z,4Z)-N-methyl-3-piperidin-1-ylhepta-2,4,6-trien-2-amine (PubChem CID 143800937) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (2Z,4Z)-N-methyl-3-piperidin-1-ylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-N-methyl-3-piperidin-1-ylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143800937 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (2Z,4Z)-N-methyl-3-piperidin-1-ylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(=C(/C)NC)N1CCCCC1 |
| InChI | InChI=1S/C13H22N2/c1-4-5-9-13(12(2)14-3)15-10-7-6-8-11-15/h4-5,9,14H,1,6-8,10-11H2,2-3H3/b9-5-,13-12- |
| InChIKey | VGOPAISKDFRBME-AICKFXJLSA-N |
| XLogP | 2.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|