C10H17N — CID 22149549
1-[(3E)-penta-1,3-dien-3-yl]piperidine (PubChem CID 22149549) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-[(3E)-penta-1,3-dien-3-yl]piperidine.
| Compound Name | 1-[(3E)-penta-1,3-dien-3-yl]piperidine |
|---|---|
| PubChem CID | 22149549 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-[(3E)-penta-1,3-dien-3-yl]piperidine |
| SMILES | C=C/C(=C\C)N1CCCCC1 |
| InChI | InChI=1S/C10H17N/c1-3-10(4-2)11-8-6-5-7-9-11/h3-4H,1,5-9H2,2H3/b10-4+ |
| InChIKey | DGYJVCIISMLIGN-ONNFQVAWSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|