C12H21N — CID 11805332
1-[(3E)-5-methylhexa-1,3-dien-2-yl]piperidine (PubChem CID 11805332) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-[(3E)-5-methylhexa-1,3-dien-2-yl]piperidine.
| Compound Name | 1-[(3E)-5-methylhexa-1,3-dien-2-yl]piperidine |
|---|---|
| PubChem CID | 11805332 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-[(3E)-5-methylhexa-1,3-dien-2-yl]piperidine |
| SMILES | C=C(/C=C/C(C)C)N1CCCCC1 |
| InChI | InChI=1S/C12H21N/c1-11(2)7-8-12(3)13-9-5-4-6-10-13/h7-8,11H,3-6,9-10H2,1-2H3/b8-7+ |
| InChIKey | NBCKCLUHIIMFIU-BQYQJAHWSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|