C15H24FN — CID 144983831
1-[(3E,5Z)-7-fluoro-5,6-dimethylocta-3,5,7-trien-3-yl]piperidine (PubChem CID 144983831) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 1-[(3E,5Z)-7-fluoro-5,6-dimethylocta-3,5,7-trien-3-yl]piperidine.
| Compound Name | 1-[(3E,5Z)-7-fluoro-5,6-dimethylocta-3,5,7-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 144983831 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 1-[(3E,5Z)-7-fluoro-5,6-dimethylocta-3,5,7-trien-3-yl]piperidine |
| SMILES | C=C(F)/C(C)=C(C)\C=C(/CC)N1CCCCC1 |
| InChI | InChI=1S/C15H24FN/c1-5-15(17-9-7-6-8-10-17)11-12(2)13(3)14(4)16/h11H,4-10H2,1-3H3/b13-12-,15-11+ |
| InChIKey | OAKKPWLZMPVSRZ-YABTVZGTSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|