C15H24FN — CID 130243379
1-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienyl]piperidine (PubChem CID 130243379) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 1-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienyl]piperidine.
| Compound Name | 1-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienyl]piperidine |
|---|---|
| PubChem CID | 130243379 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 1-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienyl]piperidine |
| SMILES | C/C(=C\C=C/C=C/F)CCCN1CCCCC1 |
| InChI | InChI=1S/C15H24FN/c1-15(9-4-2-5-11-16)10-8-14-17-12-6-3-7-13-17/h2,4-5,9,11H,3,6-8,10,12-14H2,1H3/b4-2-,11-5+,15-9+ |
| InChIKey | OKQJRKVTYXTZCY-PWNISAAPSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|