C15H27N — CID 86023806
1-(2,7-dimethylocta-2,7-dienyl)piperidine (PubChem CID 86023806) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-(2,7-dimethylocta-2,7-dienyl)piperidine.
| Compound Name | 1-(2,7-dimethylocta-2,7-dienyl)piperidine |
|---|---|
| PubChem CID | 86023806 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-(2,7-dimethylocta-2,7-dienyl)piperidine |
| SMILES | C=C(C)CCCC=C(C)CN1CCCCC1 |
| InChI | InChI=1S/C15H27N/c1-14(2)9-5-6-10-15(3)13-16-11-7-4-8-12-16/h10H,1,4-9,11-13H2,2-3H3 |
| InChIKey | IPSAYWLKLRHUGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|