C13H19N — CID 134982821
1-(1-cyclopenta-2,4-dien-1-ylidenepropyl)piperidine (PubChem CID 134982821) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-(1-cyclopenta-2,4-dien-1-ylidenepropyl)piperidine.
| Compound Name | 1-(1-cyclopenta-2,4-dien-1-ylidenepropyl)piperidine |
|---|---|
| PubChem CID | 134982821 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(1-cyclopenta-2,4-dien-1-ylidenepropyl)piperidine |
| SMILES | CCC(=C1C=CC=C1)N1CCCCC1 |
| InChI | InChI=1S/C13H19N/c1-2-13(12-8-4-5-9-12)14-10-6-3-7-11-14/h4-5,8-9H,2-3,6-7,10-11H2,1H3 |
| InChIKey | PGMBORUTNAFQDJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |