About 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine
1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine (PubChem CID 142581038) has the molecular formula C15H20FN
and a molecular weight of 233.33 g/mol. Its IUPAC name is 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine.
Molecular Properties
| Compound Name | 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine |
| PubChem CID | 142581038 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine |
| SMILES | C=C=C(C1=C(C)C=CCC1F)N1CCCCC1 |
| InChI | InChI=1S/C15H20FN/c1-3-14(17-10-5-4-6-11-17)15-12(2)8-7-9-13(15)16/h7-8,13H,1,4-6,9-11H2,2H3 |
| InChIKey | GYLSBGYTCUFDAT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine?
The IUPAC name of 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine (CID 142581038) is 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine.
What is the SMILES notation for 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine?
The canonical SMILES for 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine is C=C=C(C1=C(C)C=CCC1F)N1CCCCC1.
What is the InChIKey of 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine?
The InChIKey is GYLSBGYTCUFDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN/c1-3-14(17-10-5-4-6-11-17)15-12(2)8-7-9-13(15)16/h7-8,13H,1,4-6,9-11H2,2H3.
What are the key properties of 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine?
1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine has a molecular weight of 233.33 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6-fluoro-2-methylcyclohexa-1,3-dien-1-yl)propa-1,2-dienyl]piperidine is sourced from PubChem (CID 142581038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).